4-[5-(4-Hydroxyphenoxy)pent-3-en-1-ynyl]-2-methoxyphenol
| Internal ID | 61ce364c-e1c9-408d-bb95-5b46077d692f |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 4-[5-(4-hydroxyphenoxy)pent-3-en-1-ynyl]-2-methoxyphenol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C#CC=CCOC2=CC=C(C=C2)O)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)C#CC=CCOC2=CC=C(C=C2)O)O |
| InChI | InChI=1S/C18H16O4/c1-21-18-13-14(6-11-17(18)20)5-3-2-4-12-22-16-9-7-15(19)8-10-16/h2,4,6-11,13,19-20H,12H2,1H3 |
| InChI Key | CFTKDOICDIITEC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 4-[5-(4-Hydroxyphenoxy)pent-3-en-1-ynyl]-2-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-5-4-hydroxyphenoxypent-3-en-1-ynyl-2-methoxyphenol.jpg "2D Structure of 4-[5-(4-Hydroxyphenoxy)pent-3-en-1-ynyl]-2-methoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.50% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.04% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.50% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.01% | 96.09% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 93.55% | 98.35% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.42% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.39% | 86.33% |
| CHEMBL2487 | P05067 | Beta amyloid A4 protein | 92.14% | 96.74% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.53% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.56% | 89.62% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 88.52% | 97.53% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.21% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.47% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.25% | 96.00% |
| CHEMBL240 | Q12809 | HERG | 82.55% | 89.76% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 82.00% | 91.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.70% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.31% | 91.07% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.05% | 94.73% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.94% | 93.10% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.60% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asparagus cochinchinensis |
| PubChem | 73080615 |
| LOTUS | LTS0199755 |
| wikiData | Q104956957 |