4-[5-(3-Hydroxy-4-methoxyphenyl)-3,4-dimethyloxolan-2-yl]benzene-1,2-diol
| Internal ID | 5a87c0e1-151a-438b-86e0-591d40a7f2bf |
| Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 7,7-epoxylignans |
| IUPAC Name | 4-[5-(3-hydroxy-4-methoxyphenyl)-3,4-dimethyloxolan-2-yl]benzene-1,2-diol |
| SMILES (Canonical) | CC1C(C(OC1C2=CC(=C(C=C2)O)O)C3=CC(=C(C=C3)OC)O)C |
| SMILES (Isomeric) | CC1C(C(OC1C2=CC(=C(C=C2)O)O)C3=CC(=C(C=C3)OC)O)C |
| InChI | InChI=1S/C19H22O5/c1-10-11(2)19(13-5-7-17(23-3)16(22)9-13)24-18(10)12-4-6-14(20)15(21)8-12/h4-11,18-22H,1-3H3 |
| InChI Key | XEYABMSDSCEFHX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of 4-[5-(3-Hydroxy-4-methoxyphenyl)-3,4-dimethyloxolan-2-yl]benzene-1,2-diol](https://plantaedb.com/storage/docs/compounds/2023/11/4-5-3-hydroxy-4-methoxyphenyl-34-dimethyloxolan-2-ylbenzene-12-diol.jpg "2D Structure of 4-[5-(3-Hydroxy-4-methoxyphenyl)-3,4-dimethyloxolan-2-yl]benzene-1,2-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.84% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.94% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.62% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.93% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.52% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.45% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.44% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.24% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.03% | 92.94% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.89% | 94.73% |
| CHEMBL3194 | P02766 | Transthyretin | 82.53% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.31% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Larrea tridentata |
| PubChem | 72806513 |
| LOTUS | LTS0069273 |
| wikiData | Q105326825 |