4-(4-Hydroxyphenyl)-5-(2,3,4-trihydroxyoxolan-2-yl)oxolan-2-one
| Internal ID | 7f429a34-a448-4a8a-9d22-9c0eb4686594 |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
| IUPAC Name | 4-(4-hydroxyphenyl)-5-(2,3,4-trihydroxyoxolan-2-yl)oxolan-2-one |
| SMILES (Canonical) | C1C(C(OC1=O)C2(C(C(CO2)O)O)O)C3=CC=C(C=C3)O |
| SMILES (Isomeric) | C1C(C(OC1=O)C2(C(C(CO2)O)O)O)C3=CC=C(C=C3)O |
| InChI | InChI=1S/C14H16O7/c15-8-3-1-7(2-4-8)9-5-11(17)21-13(9)14(19)12(18)10(16)6-20-14/h1-4,9-10,12-13,15-16,18-19H,5-6H2 |
| InChI Key | VFVLKVMYKSHKCF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.08960285 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.27% | 97.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.41% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.03% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.83% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.51% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.45% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.79% | 89.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.38% | 97.79% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.37% | 85.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.05% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.63% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.32% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chamaecyparis obtusa |
| Chamaecyparis pisifera |
| PubChem | 14160575 |
| LOTUS | LTS0058225 |
| wikiData | Q104396269 |