4-[4-Hydroxy-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2-(hydroxymethyl)butyl]benzene-1,2-diol
Internal ID | b212672c-565a-444a-b461-e2156c85696f |
Taxonomy | Lignans, neolignans and related compounds > Dibenzylbutane lignans > Dibenzylbutanediol lignans |
IUPAC Name | 4-[4-hydroxy-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2-(hydroxymethyl)butyl]benzene-1,2-diol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC(CO)C(CC2=CC(=C(C=C2)O)O)CO)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)CC(CO)C(CC2=CC(=C(C=C2)O)O)CO)O |
InChI | InChI=1S/C19H24O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)14(10-20)6-12-2-4-16(22)18(24)8-12/h2-5,8-9,14-15,20-24H,6-7,10-11H2,1H3 |
InChI Key | GCAVYPNOOWBODM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O6 |
Molecular Weight | 348.40 g/mol |
Exact Mass | 348.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 93.64% | 90.20% |
CHEMBL2581 | P07339 | Cathepsin D | 92.47% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.12% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.58% | 94.45% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.76% | 90.24% |
CHEMBL2535 | P11166 | Glucose transporter | 87.59% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.45% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.94% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.47% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.65% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.31% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.97% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.18% | 90.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.86% | 95.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.26% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
PubChem | 85207202 |
LOTUS | LTS0273247 |
wikiData | Q105006177 |