4-[[(3R)-6-hydroxy-2,3-dihydro-1-benzofuran-3-yl]methyl]-5-methoxybenzene-1,3-diol
| Internal ID | a9296696-5d10-4ef2-80ea-6e383544c5d6 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 4-[[(3R)-6-hydroxy-2,3-dihydro-1-benzofuran-3-yl]methyl]-5-methoxybenzene-1,3-diol |
| SMILES (Canonical) | COC1=CC(=CC(=C1CC2COC3=C2C=CC(=C3)O)O)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1C[C@H]2COC3=C2C=CC(=C3)O)O)O |
| InChI | InChI=1S/C16H16O5/c1-20-15-7-11(18)5-14(19)13(15)4-9-8-21-16-6-10(17)2-3-12(9)16/h2-3,5-7,9,17-19H,4,8H2,1H3/t9-/m0/s1 |
| InChI Key | HZDDRSGCVZHQGM-VIFPVBQESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 4-[[(3R)-6-hydroxy-2,3-dihydro-1-benzofuran-3-yl]methyl]-5-methoxybenzene-1,3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/4-3r-6-hydroxy-23-dihydro-1-benzofuran-3-ylmethyl-5-methoxybenzene-13-diol.jpg "2D Structure of 4-[[(3R)-6-hydroxy-2,3-dihydro-1-benzofuran-3-yl]methyl]-5-methoxybenzene-1,3-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.28% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.01% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.94% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.94% | 89.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.90% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.85% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.71% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.70% | 93.99% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.64% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.08% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.85% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.28% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.09% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.62% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 84.50% | 90.71% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.30% | 83.82% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.11% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.28% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.23% | 99.15% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.65% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.49% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Campylotropis hirtella |
| PubChem | 162962802 |
| LOTUS | LTS0182707 |
| wikiData | Q105035620 |