4-[(3,4-Dihydroxyphenyl)methyl]-5-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]benzene-1,3-diol
Internal ID | 732fefa3-5740-4ac9-ad10-a1afcba44ab3 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 4-[(3,4-dihydroxyphenyl)methyl]-5-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]benzene-1,3-diol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC2=C(C(=CC(=C2)O)O)CC3=CC(=C(C=C3)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CC2=C(C(=CC(=C2)O)O)CC3=CC(=C(C=C3)O)O)O |
InChI | InChI=1S/C22H20O6/c1-28-22-10-13(3-7-19(22)25)2-5-15-11-16(23)12-20(26)17(15)8-14-4-6-18(24)21(27)9-14/h2-7,9-12,23-27H,8H2,1H3 |
InChI Key | DHOWKHPVWVNKPP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H20O6 |
Molecular Weight | 380.40 g/mol |
Exact Mass | 380.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 97.28% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.64% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.70% | 94.45% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.16% | 95.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.73% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.39% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.63% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.19% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.87% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.38% | 95.56% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.23% | 90.24% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.37% | 95.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.04% | 90.20% |
CHEMBL2535 | P11166 | Glucose transporter | 85.85% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 85.64% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.02% | 89.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.22% | 96.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.88% | 99.15% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.82% | 96.12% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.61% | 92.68% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.06% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gnetum pendulum |
PubChem | 85121619 |
LOTUS | LTS0217917 |
wikiData | Q104980667 |