[4-(3-Methyloxiran-2-yl)phenyl] 3-methylpentanoate
Internal ID | e2b82281-78c6-4fc1-8726-b4d97fa247bb |
Taxonomy | Benzenoids > Phenol esters |
IUPAC Name | [4-(3-methyloxiran-2-yl)phenyl] 3-methylpentanoate |
SMILES (Canonical) | CCC(C)CC(=O)OC1=CC=C(C=C1)C2C(O2)C |
SMILES (Isomeric) | CCC(C)CC(=O)OC1=CC=C(C=C1)C2C(O2)C |
InChI | InChI=1S/C15H20O3/c1-4-10(2)9-14(16)18-13-7-5-12(6-8-13)15-11(3)17-15/h5-8,10-11,15H,4,9H2,1-3H3 |
InChI Key | FFUFLYAPXFJSBF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O3 |
Molecular Weight | 248.32 g/mol |
Exact Mass | 248.14124450 g/mol |
Topological Polar Surface Area (TPSA) | 38.80 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of [4-(3-Methyloxiran-2-yl)phenyl] 3-methylpentanoate 2D Structure of [4-(3-Methyloxiran-2-yl)phenyl] 3-methylpentanoate](https://plantaedb.com/storage/docs/compounds/2023/11/4-3-methyloxiran-2-ylphenyl-3-methylpentanoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.38% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.26% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.94% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.23% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.84% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.40% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.31% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.99% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.16% | 96.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.96% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.01% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.83% | 90.17% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.93% | 97.21% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.34% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anisopappus pinnatifida |
PubChem | 14287120 |
LOTUS | LTS0210421 |
wikiData | Q104994676 |