4-(3-Hydroxyprop-1-enyl)-2-(3-methylbut-2-enyl)phenol
Internal ID | a3c6e6e4-3967-44df-832e-62dad460415d |
Taxonomy | Phenylpropanoids and polyketides > Cinnamyl alcohols |
IUPAC Name | 4-(3-hydroxyprop-1-enyl)-2-(3-methylbut-2-enyl)phenol |
SMILES (Canonical) | CC(=CCC1=C(C=CC(=C1)C=CCO)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC(=C1)C=CCO)O)C |
InChI | InChI=1S/C14H18O2/c1-11(2)5-7-13-10-12(4-3-9-15)6-8-14(13)16/h3-6,8,10,15-16H,7,9H2,1-2H3 |
InChI Key | UJHVAGVJXNRBBS-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C14H18O2 |
Molecular Weight | 218.29 g/mol |
Exact Mass | 218.130679813 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 3.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.96% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.21% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.54% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.55% | 86.33% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 89.71% | 96.12% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.25% | 94.73% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.44% | 91.71% |
CHEMBL2581 | P07339 | Cathepsin D | 86.86% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.86% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.75% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 83.39% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.92% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.36% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.29% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum integrifoliolum |
PubChem | 153848 |
LOTUS | LTS0231244 |
wikiData | Q105273967 |