4-(3-Hydroxybut-1-en-1-ylidene)-3,5,5-trimethylcyclohex-2-en-1-one
Internal ID | 86f3dfff-bb82-4771-91b9-95ae0cd89620 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | |
SMILES (Canonical) | CC1=CC(=O)CC(C1=C=CC(C)O)(C)C |
SMILES (Isomeric) | CC1=CC(=O)CC(C1=C=CC(C)O)(C)C |
InChI | InChI=1S/C13H18O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h5,7,10,14H,8H2,1-4H3 |
InChI Key | ZYHHDRRWYJNBAN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H18O2 |
Molecular Weight | 206.28 g/mol |
Exact Mass | 206.130679813 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 0.70 |
DTXSID50575970 |
ZYHHDRRWYJNBAN-UHFFFAOYSA-N |
4-(3-Hydroxybut-1-en-1-ylidene)-3,5,5-trimethylcyclohex-2-en-1-one |
9-Hydroxymegastigma-4,6,7-trien-3-one |
Megastigma-4,6,7-trien-3-one, 9-hydroxy |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.86% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.03% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.91% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.15% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.42% | 94.45% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 88.54% | 85.30% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.01% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.98% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.36% | 94.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.65% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.25% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.74% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitis vinifera |
PubChem | 15624538 |
LOTUS | LTS0083937 |
wikiData | Q82465463 |