4-(3-Hydroxy-5-methylphenoxy)-5-methylbenzene-1,3-diol
| Internal ID | 92a137a5-1203-44bb-9337-c9a0f395efbe |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylethers |
| IUPAC Name | 4-(3-hydroxy-5-methylphenoxy)-5-methylbenzene-1,3-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H14O4/c1-8-3-10(15)6-12(4-8)18-14-9(2)5-11(16)7-13(14)17/h3-7,15-17H,1-2H3 |
| InChI Key | AKAZFIHJYKLCAR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.27% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.95% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.01% | 90.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.87% | 93.65% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.17% | 92.68% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.14% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.02% | 95.56% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.83% | 96.12% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.54% | 94.00% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 83.64% | 95.70% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.61% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.88% | 99.17% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.27% | 91.79% |
| CHEMBL3194 | P02766 | Transthyretin | 80.57% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 42629488 |
| LOTUS | LTS0212223 |
| wikiData | Q104913517 |