4-[3-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)propyl]-2-methoxyphenol
Internal ID | 2a82c9c3-47f0-4945-943d-2da3e06ecb56 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 4-[3-hydroxy-2-(4-hydroxy-3-methoxyphenyl)propyl]-2-methoxyphenol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC(CO)C2=CC(=C(C=C2)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)CC(CO)C2=CC(=C(C=C2)O)OC)O |
InChI | InChI=1S/C17H20O5/c1-21-16-8-11(3-5-14(16)19)7-13(10-18)12-4-6-15(20)17(9-12)22-2/h3-6,8-9,13,18-20H,7,10H2,1-2H3 |
InChI Key | UALDQSUIGCFUNY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H20O5 |
Molecular Weight | 304.34 g/mol |
Exact Mass | 304.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 79.20 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.82% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.10% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.42% | 98.95% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 92.67% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.31% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.26% | 99.17% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.83% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.97% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 87.99% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.25% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.68% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.25% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.78% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.04% | 96.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.95% | 89.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.84% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Durio zibethinus |
PubChem | 13908507 |
LOTUS | LTS0244476 |
wikiData | Q105268872 |