4-[3-(3-Hydroxy-4-methoxyphenyl)prop-2-enyl]-2,3-dimethoxyphenol
| Internal ID | 7e29dd51-16d8-4002-9ad7-4db418131d9b |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Cinnamylphenols |
| IUPAC Name | 4-[3-(3-hydroxy-4-methoxyphenyl)prop-2-enyl]-2,3-dimethoxyphenol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C=CCC2=C(C(=C(C=C2)O)OC)OC)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C=CCC2=C(C(=C(C=C2)O)OC)OC)O |
| InChI | InChI=1S/C18H20O5/c1-21-16-10-7-12(11-15(16)20)5-4-6-13-8-9-14(19)18(23-3)17(13)22-2/h4-5,7-11,19-20H,6H2,1-3H3 |
| InChI Key | LNXCGMDIRKMWRL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.10% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.33% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.31% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.29% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.00% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 89.81% | 90.71% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.09% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.91% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.25% | 90.20% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.33% | 91.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.20% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.04% | 90.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.79% | 90.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.83% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.28% | 96.95% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 81.11% | 80.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalbergia candenatensis |
| PubChem | 74976113 |
| LOTUS | LTS0082385 |
| wikiData | Q105154557 |