4-(3-(1,3-Benzodioxol-5-yl)-1-oxo-2-propenyl)morpholine
Internal ID | 0f508b74-660c-4e99-a7f9-f8eb878b27c7 |
Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-morpholin-4-ylprop-2-en-1-one |
SMILES (Canonical) | C1COCCN1C(=O)C=CC2=CC3=C(C=C2)OCO3 |
SMILES (Isomeric) | C1COCCN1C(=O)/C=C/C2=CC3=C(C=C2)OCO3 |
InChI | InChI=1S/C14H15NO4/c16-14(15-5-7-17-8-6-15)4-2-11-1-3-12-13(9-11)19-10-18-12/h1-4,9H,5-8,10H2/b4-2+ |
InChI Key | YGGASQPEKIGCKJ-DUXPYHPUSA-N |
Popularity | 2 references in papers |
Molecular Formula | C14H15NO4 |
Molecular Weight | 261.27 g/mol |
Exact Mass | 261.10010796 g/mol |
Topological Polar Surface Area (TPSA) | 48.00 Ų |
XlogP | 1.60 |
CHEMBL118703 |
74957-53-2 |
Morpholine, 4-(3-(1,3-benzodioxol-5-yl)-1-oxo-2-propenyl)- |
MLS000562661 |
3-Benzo[1,3]dioxol-5-yl-1-morpholin-4-yl-propenone |
SCHEMBL20866523 |
HMS2330K17 |
BDBM50401985 |
STK416912 |
AKOS000536036 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
31622.8 nM |
Potency |
PMID: 18183025
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
35481.3 nM |
Potency |
PMID: 18989978
|
CHEMBL2039 | P27338 | Monoamine oxidase B |
6390 nM |
IC50 |
PMID: 22014827
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.54% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.21% | 96.77% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.80% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.20% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.77% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.46% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.41% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.02% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 89.18% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.50% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.74% | 96.09% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.56% | 90.24% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.29% | 87.67% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.90% | 94.80% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.25% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper nigrum |
PubChem | 682145 |
NPASS | NPC469808 |
ChEMBL | CHEMBL118703 |
LOTUS | LTS0067355 |
wikiData | Q105348074 |