[4-[(2R)-7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl]-2-methoxyphenyl] acetate
| Internal ID | 8fdc8fa0-ef89-40c2-af67-b83d9698368d |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 3-O-methylated flavonoids |
| IUPAC Name | [4-[(2R)-7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl]-2-methoxyphenyl] acetate |
| SMILES (Canonical) | CC1=C(C2=C(C(=C1OC(=O)C)C)OC(CC2=O)C3=CC(=C(C=C3)OC(=O)C)OC)O |
| SMILES (Isomeric) | CC1=C(C2=C(C(=C1OC(=O)C)C)O[C@H](CC2=O)C3=CC(=C(C=C3)OC(=O)C)OC)O |
| InChI | InChI=1S/C22H22O8/c1-10-20(26)19-15(25)9-17(30-22(19)11(2)21(10)29-13(4)24)14-6-7-16(28-12(3)23)18(8-14)27-5/h6-8,17,26H,9H2,1-5H3/t17-/m1/s1 |
| InChI Key | AOLRIXVCSLTLKV-QGZVFWFLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.13146766 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of [4-[(2R)-7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl]-2-methoxyphenyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/4-2r-7-acetyloxy-5-hydroxy-68-dimethyl-4-oxo-23-dihydrochromen-2-yl-2-methoxyphenyl-acetate.jpg "2D Structure of [4-[(2R)-7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl]-2-methoxyphenyl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.11% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.44% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.08% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.46% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.45% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.76% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.44% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.21% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.84% | 98.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.22% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.54% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.48% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.57% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.65% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Qualea labouriauana |
| PubChem | 162863078 |
| LOTUS | LTS0128659 |
| wikiData | Q104915778 |