[4-[(2R)-2-methyloxiran-2-yl]-3-(2-methylpropanoyloxy)phenyl]methyl (2S)-2-methylbutanoate
| Internal ID | cc0a10bc-2d2f-47a6-966a-e08b5bc34faa |
| Taxonomy | Benzenoids > Phenol esters |
| IUPAC Name | [4-[(2R)-2-methyloxiran-2-yl]-3-(2-methylpropanoyloxy)phenyl]methyl (2S)-2-methylbutanoate |
| SMILES (Canonical) | CCC(C)C(=O)OCC1=CC(=C(C=C1)C2(CO2)C)OC(=O)C(C)C |
| SMILES (Isomeric) | CC[C@H](C)C(=O)OCC1=CC(=C(C=C1)[C@@]2(CO2)C)OC(=O)C(C)C |
| InChI | InChI=1S/C19H26O5/c1-6-13(4)18(21)22-10-14-7-8-15(19(5)11-23-19)16(9-14)24-17(20)12(2)3/h7-9,12-13H,6,10-11H2,1-5H3/t13-,19-/m0/s1 |
| InChI Key | NLNNOYIIACIFGJ-DJJJIMSYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 65.10 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
![2D Structure of [4-[(2R)-2-methyloxiran-2-yl]-3-(2-methylpropanoyloxy)phenyl]methyl (2S)-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/4-2r-2-methyloxiran-2-yl-3-2-methylpropanoyloxyphenylmethyl-2s-2-methylbutanoate.jpg "2D Structure of [4-[(2R)-2-methyloxiran-2-yl]-3-(2-methylpropanoyloxy)phenyl]methyl (2S)-2-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.74% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.09% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.98% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.56% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.79% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.69% | 99.17% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 88.22% | 96.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.79% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.62% | 86.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.08% | 95.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.59% | 90.71% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.18% | 89.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.11% | 96.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.80% | 95.89% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.71% | 96.77% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.44% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.21% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.64% | 94.73% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.54% | 95.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.28% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gaillardia aristata |
| PubChem | 163003973 |
| LOTUS | LTS0212081 |
| wikiData | Q105181467 |