4-[2-Methyl-5-(2-methylpropyl)phenyl]butan-2-one
Internal ID | 5eb9de7f-f3b9-40b5-986a-2760744325e7 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenylpropanes |
IUPAC Name | 4-[2-methyl-5-(2-methylpropyl)phenyl]butan-2-one |
SMILES (Canonical) | CC1=C(C=C(C=C1)CC(C)C)CCC(=O)C |
SMILES (Isomeric) | CC1=C(C=C(C=C1)CC(C)C)CCC(=O)C |
InChI | InChI=1S/C15H22O/c1-11(2)9-14-7-5-12(3)15(10-14)8-6-13(4)16/h5,7,10-11H,6,8-9H2,1-4H3 |
InChI Key | NTOMHKYRNVDEMJ-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C15H22O |
Molecular Weight | 218.33 g/mol |
Exact Mass | 218.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 3.80 |
There are no found synonyms. |
![2D Structure of 4-[2-Methyl-5-(2-methylpropyl)phenyl]butan-2-one 2D Structure of 4-[2-Methyl-5-(2-methylpropyl)phenyl]butan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-methyl-5-2-methylpropylphenylbutan-2-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.24% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.85% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.14% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.92% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.66% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.15% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.48% | 90.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.29% | 95.50% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.32% | 90.24% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.26% | 97.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.19% | 86.33% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.44% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.04% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.42% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 80.42% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.10% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taiwania cryptomerioides |
Tribulus terrestris |
PubChem | 21580083 |
LOTUS | LTS0103764 |
wikiData | Q105330605 |