[4-(2-Hydroxyethenyl)phenyl] 4-hydroxy-3-nitrosobenzoate
| Internal ID | 45887251-b2ae-43b0-bae4-81dd26398ce0 |
| Taxonomy | Phenylpropanoids and polyketides > Depsides and depsidones |
| IUPAC Name | [4-(2-hydroxyethenyl)phenyl] 4-hydroxy-3-nitrosobenzoate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H11NO5/c17-8-7-10-1-4-12(5-2-10)21-15(19)11-3-6-14(18)13(9-11)16-20/h1-9,17-18H |
| InChI Key | PBSUTSPSCBYDLK-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06372245 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of [4-(2-Hydroxyethenyl)phenyl] 4-hydroxy-3-nitrosobenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-hydroxyethenylphenyl-4-hydroxy-3-nitrosobenzoate.jpg "2D Structure of [4-(2-Hydroxyethenyl)phenyl] 4-hydroxy-3-nitrosobenzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 95.09% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.29% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.88% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.07% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.40% | 99.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.47% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.82% | 98.75% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.39% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.32% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.86% | 90.71% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 82.61% | 89.49% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 82.06% | 87.67% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.54% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73161163 |
| LOTUS | LTS0134567 |
| wikiData | Q104194240 |