4-(2-Hydroxy-4,5-dimethoxy-7-methylnaphthalen-1-yl)-8-methoxy-3-methylnaphthalene-1,7-diol
| Internal ID | 236ab4c7-8081-4aff-a60d-121403d78d32 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthols and derivatives |
| IUPAC Name | 4-(2-hydroxy-4,5-dimethoxy-7-methylnaphthalen-1-yl)-8-methoxy-3-methylnaphthalene-1,7-diol |
| SMILES (Canonical) | CC1=CC2=C(C(=CC(=C2C(=C1)OC)OC)O)C3=C4C=CC(=C(C4=C(C=C3C)O)OC)O |
| SMILES (Isomeric) | CC1=CC2=C(C(=CC(=C2C(=C1)OC)OC)O)C3=C4C=CC(=C(C4=C(C=C3C)O)OC)O |
| InChI | InChI=1S/C25H24O6/c1-12-8-15-22(18(28)11-20(30-4)24(15)19(9-12)29-3)21-13(2)10-17(27)23-14(21)6-7-16(26)25(23)31-5/h6-11,26-28H,1-5H3 |
| InChI Key | KYRRSHUVTJJQPB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.15728848 g/mol |
| Topological Polar Surface Area (TPSA) | 88.40 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.11% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.82% | 99.15% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.50% | 89.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.54% | 94.45% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.91% | 91.79% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.52% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.15% | 94.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.48% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.23% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.86% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.29% | 98.95% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.08% | 96.21% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.99% | 80.78% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.46% | 90.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.35% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.27% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 80.21% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10251563 |
| LOTUS | LTS0082723 |
| wikiData | Q105147897 |