4-[2-Hydroxy-3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol
| Internal ID | 45d9765b-178e-447e-8c77-d2a9358ad929 |
| Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Cinnamylphenols |
| IUPAC Name | 4-[2-hydroxy-3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol |
| SMILES (Canonical) | COC1=CC(=C(C=C1)CC(CC2=CC(=C(C=C2)O)OC)O)O |
| SMILES (Isomeric) | COC1=CC(=C(C=C1)CC(CC2=CC(=C(C=C2)O)OC)O)O |
| InChI | InChI=1S/C17H20O5/c1-21-14-5-4-12(16(20)10-14)9-13(18)7-11-3-6-15(19)17(8-11)22-2/h3-6,8,10,13,18-20H,7,9H2,1-2H3 |
| InChI Key | KBYCDKQJYCDHFN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.98% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.22% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.88% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.77% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.38% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.00% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.08% | 98.75% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 90.20% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.01% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.72% | 94.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.24% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.88% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.06% | 90.20% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.64% | 90.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.96% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.61% | 95.89% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.33% | 93.18% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.57% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Virola elongata |
| Virola surinamensis |
| PubChem | 163037668 |
| LOTUS | LTS0037696 |
| wikiData | Q105138600 |