4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-2-methylbut-2-enal
Internal ID | ae7fa1c6-ad95-49de-9871-b0d144439301 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 4-(2-hydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-2-methylbut-2-enal |
SMILES (Canonical) | CC(=CCC1C2(CCCC(C2CCC1(C)O)(C)C)C)C=O |
SMILES (Isomeric) | CC(=CCC1C2(CCCC(C2CCC1(C)O)(C)C)C)C=O |
InChI | InChI=1S/C19H32O2/c1-14(13-20)7-8-16-18(4)11-6-10-17(2,3)15(18)9-12-19(16,5)21/h7,13,15-16,21H,6,8-12H2,1-5H3 |
InChI Key | TUMRPMCXIBJVMV-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H32O2 |
Molecular Weight | 292.50 g/mol |
Exact Mass | 292.240230259 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 4.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.26% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.67% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.34% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.29% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.93% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.71% | 96.61% |
CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 85.48% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.31% | 95.50% |
CHEMBL2581 | P07339 | Cathepsin D | 84.88% | 98.95% |
CHEMBL233 | P35372 | Mu opioid receptor | 84.82% | 97.93% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.31% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.70% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.64% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.00% | 96.38% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.86% | 99.18% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.91% | 93.00% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.89% | 95.92% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.86% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.31% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.44% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.29% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana tabacum |
PubChem | 162899287 |
LOTUS | LTS0216319 |
wikiData | Q105264863 |