4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4,8,8-tetramethyl-4a,5,6,7-tetrahydro-3H-naphthalen-2-one
| Internal ID | f463e1b9-3af3-45ca-aed3-173bd6ed8ac8 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
| IUPAC Name | 4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4,8,8-tetramethyl-4a,5,6,7-tetrahydro-3H-naphthalen-2-one |
| SMILES (Canonical) | CC1C(=O)C=C2C(C1(C)CCC3=COC=C3)CCC(C2(C)C)O |
| SMILES (Isomeric) | CC1C(=O)C=C2C(C1(C)CCC3=COC=C3)CCC(C2(C)C)O |
| InChI | InChI=1S/C20H28O3/c1-13-17(21)11-16-15(5-6-18(22)19(16,2)3)20(13,4)9-7-14-8-10-23-12-14/h8,10-13,15,18,22H,5-7,9H2,1-4H3 |
| InChI Key | KRLGALLDUXJJQN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20384475 g/mol |
| Topological Polar Surface Area (TPSA) | 50.40 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4,8,8-tetramethyl-4a,5,6,7-tetrahydro-3H-naphthalen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-furan-3-ylethyl-7-hydroxy-3488-tetramethyl-4a567-tetrahydro-3h-naphthalen-2-one.jpg "2D Structure of 4-[2-(furan-3-yl)ethyl]-7-hydroxy-3,4,8,8-tetramethyl-4a,5,6,7-tetrahydro-3H-naphthalen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.37% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.39% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.18% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.66% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.71% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.06% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.84% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.69% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.98% | 93.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.51% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.22% | 97.25% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.00% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.88% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.19% | 90.71% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.50% | 94.80% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.19% | 97.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.18% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.37% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acalypha macrostachya |
| PubChem | 162928659 |
| LOTUS | LTS0086197 |
| wikiData | Q105145105 |