4-[2-(Dimethylamino)-3-hydroxy-8,10-dimethyldodec-6-enyl]phenol
| Internal ID | a7fc6381-c255-4e04-b775-5b0541cad440 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenethylamines > Amphetamines and derivatives |
| IUPAC Name | 4-[2-(dimethylamino)-3-hydroxy-8,10-dimethyldodec-6-enyl]phenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C22H37NO2/c1-6-17(2)15-18(3)9-7-8-10-22(25)21(23(4)5)16-19-11-13-20(24)14-12-19/h7,9,11-14,17-18,21-22,24-25H,6,8,10,15-16H2,1-5H3 |
| InChI Key | KUPOHNLIXOKKCF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.282429423 g/mol |
| Topological Polar Surface Area (TPSA) | 43.70 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
![2D Structure of 4-[2-(Dimethylamino)-3-hydroxy-8,10-dimethyldodec-6-enyl]phenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-dimethylamino-3-hydroxy-810-dimethyldodec-6-enylphenol.jpg "2D Structure of 4-[2-(Dimethylamino)-3-hydroxy-8,10-dimethyldodec-6-enyl]phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.11% | 98.95% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 96.96% | 98.35% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.28% | 96.09% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 91.84% | 97.64% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.99% | 99.17% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.65% | 93.10% |
| CHEMBL268 | P43235 | Cathepsin K | 89.23% | 96.85% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.81% | 94.73% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 87.79% | 91.23% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.39% | 90.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.23% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.61% | 95.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.02% | 95.93% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.28% | 95.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.87% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.20% | 91.11% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.08% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.07% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.20% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 78155621 |
| LOTUS | LTS0126992 |
| wikiData | Q104170610 |