[4-(2-aminoethyl)phenyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
| Internal ID | e6c364af-a6e0-4465-89d5-462899c307b7 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
| IUPAC Name | [4-(2-aminoethyl)phenyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OC2=CC=C(C=C2)CCN)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)OC2=CC=C(C=C2)CCN)O |
| InChI | InChI=1S/C18H19NO4/c1-22-17-12-14(4-8-16(17)20)5-9-18(21)23-15-6-2-13(3-7-15)10-11-19/h2-9,12,20H,10-11,19H2,1H3/b9-5+ |
| InChI Key | XWDDIZKKSZLMEB-WEVVVXLNSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.13140809 g/mol |
| Topological Polar Surface Area (TPSA) | 81.80 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of [4-(2-aminoethyl)phenyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-aminoethylphenyl-e-3-4-hydroxy-3-methoxyphenylprop-2-enoate.jpg "2D Structure of [4-(2-aminoethyl)phenyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.22% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.61% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.71% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.39% | 99.17% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 95.03% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.72% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 93.40% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.80% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.57% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.52% | 96.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.92% | 90.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.38% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.89% | 98.75% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.17% | 93.18% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.35% | 86.92% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.03% | 91.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.31% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.06% | 95.89% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.25% | 97.53% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.12% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piptostigma fugax |
| PubChem | 15694367 |
| LOTUS | LTS0093426 |
| wikiData | Q105343319 |