4-[2-(4-Hydroxy-3,5-dimethyl-2-oxocyclohexylidene)ethyl]piperidine-2,6-dione
| Internal ID | 2e5d2b9d-f281-489e-a494-243b9cd074ee |
| Taxonomy | Organoheterocyclic compounds > Piperidines > Piperidinones > Piperidinediones |
| IUPAC Name | 4-[2-(4-hydroxy-3,5-dimethyl-2-oxocyclohexylidene)ethyl]piperidine-2,6-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H21NO4/c1-8-5-11(15(20)9(2)14(8)19)4-3-10-6-12(17)16-13(18)7-10/h4,8-10,14,19H,3,5-7H2,1-2H3,(H,16,17,18) |
| InChI Key | NDZXLILZQFUNLL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 83.50 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 93.92% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.86% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.44% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.95% | 97.25% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.78% | 89.34% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 87.99% | 85.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.82% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.47% | 94.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.96% | 98.59% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.43% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.96% | 97.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.70% | 90.08% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.23% | 98.03% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.17% | 83.82% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.54% | 95.92% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.08% | 90.71% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.04% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162889389 |
| LOTUS | LTS0177208 |
| wikiData | Q104172383 |