4-[2-(4-Hydroxy-3-methylphenyl)ethyl]-2,6-dimethoxyphenol
| Internal ID | 23c5192f-b741-49dd-97dc-5feac00a66ae |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 4-[2-(4-hydroxy-3-methylphenyl)ethyl]-2,6-dimethoxyphenol |
| SMILES (Canonical) | CC1=C(C=CC(=C1)CCC2=CC(=C(C(=C2)OC)O)OC)O |
| SMILES (Isomeric) | CC1=C(C=CC(=C1)CCC2=CC(=C(C(=C2)OC)O)OC)O |
| InChI | InChI=1S/C17H20O4/c1-11-8-12(6-7-14(11)18)4-5-13-9-15(20-2)17(19)16(10-13)21-3/h6-10,18-19H,4-5H2,1-3H3 |
| InChI Key | INKAYXWJFUKHKS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 4-[2-(4-Hydroxy-3-methylphenyl)ethyl]-2,6-dimethoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-4-hydroxy-3-methylphenylethyl-26-dimethoxyphenol.jpg "2D Structure of 4-[2-(4-Hydroxy-3-methylphenyl)ethyl]-2,6-dimethoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.88% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.50% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.07% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.92% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.72% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.08% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.89% | 99.17% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.97% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.81% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.96% | 85.14% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.30% | 92.62% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.27% | 92.68% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.36% | 95.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.32% | 98.75% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 82.13% | 95.70% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.92% | 94.73% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.57% | 86.92% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.28% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium moniliforme |
| PubChem | 162935727 |
| LOTUS | LTS0205995 |
| wikiData | Q105116252 |