4-[2-(3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]piperidine-2,6-dione
| Internal ID | d0a1210a-cc2c-46f0-a600-1f9421e6bb70 |
| Taxonomy | Organoheterocyclic compounds > Piperidines > Piperidinones > Piperidinediones |
| IUPAC Name | 4-[2-(3,5-dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]piperidine-2,6-dione |
| SMILES (Canonical) | CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C |
| SMILES (Isomeric) | CC1CC(C(=O)C(C1)C(CC2CC(=O)NC(=O)C2)O)C |
| InChI | InChI=1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19) |
| InChI Key | YPHMISFOHDHNIV-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 83.50 Ų |
| XlogP | 0.50 |
| 4-[2-(3,5-dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]piperidine-2,6-dione |
| Acti-Dione |
| 6746-42-5 |
| 17280-60-3 |
| 4-[2-(3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]-2,6-piperidinedione |
| D-Isocycloheximide |
| Cyclohemimide |
| Cyclohexamide |
| Aktidion |
| Actidione TGF |
| There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 4-[2-(3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]piperidine-2,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-35-dimethyl-2-oxocyclohexyl-2-hydroxyethylpiperidine-26-dione.jpg "2D Structure of 4-[2-(3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]piperidine-2,6-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
251.2 nM |
Potency |
via Super-PRED
|
| CHEMBL2052028 | P60842 | Eukaryotic initiation factor 4A-I |
87 nM |
IC50 |
via Super-PRED
|
| CHEMBL5514 | P42858 | Huntingtin |
354.8 nM |
Potency |
via Super-PRED
|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
63.1 nM |
Potency |
via Super-PRED
|
| CHEMBL4040 | P28482 | MAP kinase ERK2 |
39.8 nM |
Potency |
via Super-PRED
|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
446.7 nM 316.2 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
316.2 nM 316.2 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
446.7 nM 891.3 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.34% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.96% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.17% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.78% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.52% | 97.09% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 86.65% | 98.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.32% | 95.56% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.11% | 96.61% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.30% | 89.34% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.53% | 90.08% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.37% | 100.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.47% | 95.56% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.12% | 85.11% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 80.99% | 97.63% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.32% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 2900 |
| LOTUS | LTS0094240 |
| wikiData | Q27163592 |