[4-[2-(3,5-Dihydroxyphenyl)ethyl]-2-(3-methylbut-2-enyl)phenyl] acetate
Internal ID | 19559ef5-43a6-4ff8-8e2c-d489ab350877 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | [4-[2-(3,5-dihydroxyphenyl)ethyl]-2-(3-methylbut-2-enyl)phenyl] acetate |
SMILES (Canonical) | CC(=CCC1=C(C=CC(=C1)CCC2=CC(=CC(=C2)O)O)OC(=O)C)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC(=C1)CCC2=CC(=CC(=C2)O)O)OC(=O)C)C |
InChI | InChI=1S/C21H24O4/c1-14(2)4-8-18-10-16(7-9-21(18)25-15(3)22)5-6-17-11-19(23)13-20(24)12-17/h4,7,9-13,23-24H,5-6,8H2,1-3H3 |
InChI Key | ULZWZZSQPOWPSG-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H24O4 |
Molecular Weight | 340.40 g/mol |
Exact Mass | 340.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 5.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.62% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.20% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.06% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.52% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.88% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.34% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.28% | 94.73% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.43% | 96.95% |
CHEMBL3194 | P02766 | Transthyretin | 85.62% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 84.05% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.83% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.84% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza glabra |
PubChem | 11244716 |
LOTUS | LTS0193530 |
wikiData | Q105275444 |