4-[2-(3-Hydroxy-5-methoxyphenyl)ethenyl]-2,3-dimethoxyphenol
| Internal ID | b4279368-6046-4ee0-9bed-9d995bdb266b |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 4-[2-(3-hydroxy-5-methoxyphenyl)ethenyl]-2,3-dimethoxyphenol |
| SMILES (Canonical) | COC1=CC(=CC(=C1)O)C=CC2=C(C(=C(C=C2)O)OC)OC |
| SMILES (Isomeric) | COC1=CC(=CC(=C1)O)C=CC2=C(C(=C(C=C2)O)OC)OC |
| InChI | InChI=1S/C17H18O5/c1-20-14-9-11(8-13(18)10-14)4-5-12-6-7-15(19)17(22-3)16(12)21-2/h4-10,18-19H,1-3H3 |
| InChI Key | VACLJIVMBBSOOR-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.18% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 93.65% | 90.71% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 93.52% | 92.68% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.98% | 99.15% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.97% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.32% | 86.33% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 84.92% | 80.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.64% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.59% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.56% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.50% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.86% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.04% | 94.45% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.69% | 91.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.23% | 98.75% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 80.88% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coelogyne kouytcheensis |
| PubChem | 73006688 |
| LOTUS | LTS0214172 |
| wikiData | Q105282627 |