4-[2-[1-(4-Hydroxy-3-methoxyphenyl)prop-1-en-2-yloxy]prop-1-enyl]-2-methoxyphenol
| Internal ID | 78904a8b-6017-49b1-b093-c5f0dcab636f |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 4-[2-[1-(4-hydroxy-3-methoxyphenyl)prop-1-en-2-yloxy]prop-1-enyl]-2-methoxyphenol |
| SMILES (Canonical) | CC(=CC1=CC(=C(C=C1)O)OC)OC(=CC2=CC(=C(C=C2)O)OC)C |
| SMILES (Isomeric) | CC(=CC1=CC(=C(C=C1)O)OC)OC(=CC2=CC(=C(C=C2)O)OC)C |
| InChI | InChI=1S/C20H22O5/c1-13(9-15-5-7-17(21)19(11-15)23-3)25-14(2)10-16-6-8-18(22)20(12-16)24-4/h5-12,21-22H,1-4H3 |
| InChI Key | YSFQCTIEWTYEKD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of 4-[2-[1-(4-Hydroxy-3-methoxyphenyl)prop-1-en-2-yloxy]prop-1-enyl]-2-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/4-2-1-4-hydroxy-3-methoxyphenylprop-1-en-2-yloxyprop-1-enyl-2-methoxyphenol.jpg "2D Structure of 4-[2-[1-(4-Hydroxy-3-methoxyphenyl)prop-1-en-2-yloxy]prop-1-enyl]-2-methoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.08% | 91.49% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.21% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.14% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.10% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.22% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 86.65% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.51% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.25% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.57% | 90.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 84.30% | 98.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.97% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.84% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.37% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.22% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Leucosyke quadrinervia |
| PubChem | 162956058 |
| LOTUS | LTS0061939 |
| wikiData | Q105359586 |