4-(1H-indol-3-yl)pyrimidin-2-amine
| Internal ID | 3e3e90f6-1445-48e4-940e-4e55ac48322a |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles |
| IUPAC Name | 4-(1H-indol-3-yl)pyrimidin-2-amine |
| SMILES (Canonical) | C1=CC=C2C(=C1)C(=CN2)C3=NC(=NC=C3)N |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C(=CN2)C3=NC(=NC=C3)N |
| InChI | InChI=1S/C12H10N4/c13-12-14-6-5-11(16-12)9-7-15-10-4-2-1-3-8(9)10/h1-7,15H,(H2,13,14,16) |
| InChI Key | QNMZWFNNJMGJPU-UHFFFAOYSA-N |
| Popularity | 18 references in papers |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.090546336 g/mol |
| Topological Polar Surface Area (TPSA) | 67.60 Ų |
| XlogP | 1.60 |
| 289628-76-8 |
| 2-AMINO-4-(3-INDOLYL)PYRIMIDINE |
| 4-(1~{H}-indol-3-yl)pyrimidin-2-amine |
| Meridianin G |
| 2-Pyrimidinamine, 4-(1H-indol-3-yl)- |
| 6-debromomeridianin D |
| CHEMBL48082 |
| SCHEMBL573402 |
| SCHEMBL4564892 |
| BDBM10844 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 |
530 nM |
IC50 |
via Super-PRED
|
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A |
588 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.44% | 91.49% |
| CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 97.29% | 96.11% |
| CHEMBL5543 | Q9Y463 | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | 94.24% | 94.70% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 91.28% | 82.86% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 91.19% | 91.38% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.47% | 94.62% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.87% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.42% | 94.00% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 87.87% | 91.73% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 86.41% | 96.67% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 86.37% | 95.48% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.28% | 96.09% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 86.27% | 96.39% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.74% | 98.75% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.75% | 96.00% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 83.49% | 81.14% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.67% | 83.10% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.47% | 88.56% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.56% | 93.81% |
| CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 81.27% | 95.50% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 81.23% | 88.42% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.20% | 95.56% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 80.53% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 400433 |
| LOTUS | LTS0083558 |
| wikiData | Q82090182 |