[(3S,6S)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-yl] acetate
| Internal ID | 4d65ee43-a6eb-4e55-97b8-3fdc9b7e17cd |
| Taxonomy | Organoheterocyclic compounds > Oxanes |
| IUPAC Name | [(3S,6S)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CCC(OC1(C)C)(C)C2CCC(C=C2)(C)O |
| SMILES (Isomeric) | CC(=O)O[C@H]1CC[C@@](OC1(C)C)(C)[C@H]2CC[C@@](C=C2)(C)O |
| InChI | InChI=1S/C17H28O4/c1-12(18)20-14-8-11-17(5,21-15(14,2)3)13-6-9-16(4,19)10-7-13/h6,9,13-14,19H,7-8,10-11H2,1-5H3/t13-,14+,16+,17+/m1/s1 |
| InChI Key | WJWZGGQNMPMICF-OHFALNGGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.19875937 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of [(3S,6S)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/3s6s-6-1s4r-4-hydroxy-4-methylcyclohex-2-en-1-yl-226-trimethyloxan-3-yl-acetate.jpg "2D Structure of [(3S,6S)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2,2,6-trimethyloxan-3-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.91% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.07% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.09% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.82% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.56% | 91.19% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.31% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.62% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.59% | 85.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.68% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.65% | 92.94% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.53% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.42% | 99.23% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.24% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia lucentica |
| PubChem | 101708809 |
| LOTUS | LTS0097058 |
| wikiData | Q105307101 |