(3S,6S)-3,6-Diisopropylpiperazine-2,5-dione
| Internal ID | 57867be0-f56a-49bd-8b59-517a1644cf09 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | (3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H18N2O2/c1-5(2)7-9(13)12-8(6(3)4)10(14)11-7/h5-8H,1-4H3,(H,11,14)(H,12,13)/t7-,8-/m0/s1 |
| InChI Key | QGMAWEIDGADSAC-YUMQZZPRSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.136827821 g/mol |
| Topological Polar Surface Area (TPSA) | 58.20 Ų |
| XlogP | 1.40 |
| 19943-16-9 |
| 2,5-Piperazinedione, 3,6-bis(1-methylethyl)-, (3S,6S)- |
| (3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione |
| Cyclo(val-val) |
| Val-Val diketopiperazine |
| (3S,6S)-3,6-bis(propan-2-yl)piperazine-2,5-dione |
| SCHEMBL6439630 |
| CHEMBL2205314 |
| QGMAWEIDGADSAC-YUMQZZPRSA-N |
| MFCD00237622 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.79% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.56% | 94.75% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.51% | 90.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.46% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.60% | 95.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.63% | 97.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.17% | 94.45% |
| CHEMBL1949 | P62937 | Cyclophilin A | 82.40% | 98.57% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.82% | 97.25% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.20% | 88.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 7075896 |
| LOTUS | LTS0129521 |
| wikiData | Q105220408 |