Scytalol A
| Internal ID | 7e01cf45-de83-4e52-be65-6fce78b7ffe9 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | (3S,5R)-3,5,9-trihydroxy-7-methoxy-3-methyl-4,4a,5,10a-tetrahydro-1H-benzo[g]isochromen-10-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H18O6/c1-15(19)5-9-10(6-21-15)14(18)12-8(13(9)17)3-7(20-2)4-11(12)16/h3-4,9-10,13,16-17,19H,5-6H2,1-2H3/t9?,10?,13-,15-/m0/s1 |
| InChI Key | GGAUEUZYPJSVMZ-NDQGGDCISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11033829 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 0.70 |
| (3S,5R)-3,5,9-trihydroxy-7-methoxy-3-methyl-4,4a,5,10a-tetrahydro-1H-benzo[g]isochromen-10-one |
| (3S,4aR,5R,10aS)-3,5,9-trihydroxy-7-methoxy-3-methyl-4,4a,5,10a-tetrahydro-1H-benzo(g)isochromen-10-one |
| (3S,4aR,5R,10aS)-3,5,9-trihydroxy-7-methoxy-3-methyl-4,4a,5,10a-tetrahydro-1H-benzo[g]isochromen-10-one |
| (3S,5R)-3,5,9-trihydroxy-7-methoxy-3-methyl-4,4a,5,10a-tetrahydro-1H-benzo(g)isochromen-10-one |
| 208183-19-1 |
| RefChem:182054 |
| CHEBI:203336 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.30% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.93% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.13% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.49% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.80% | 89.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.76% | 91.07% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.71% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.69% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.17% | 92.94% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.96% | 92.68% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.55% | 90.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.47% | 97.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.44% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.68% | 91.19% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.48% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.65% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.50% | 99.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.53% | 92.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.08% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584855 |
| LOTUS | LTS0135629 |
| wikiData | Q77376983 |