(3S,3aS,9bS)-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione
Internal ID | ca1d2dc3-3c58-442f-a0b7-952439201aba |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | (3S,3aS,9bS)-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
SMILES (Canonical) | CC1C2CCC(=C3C(C2OC1=O)C(=CC3=O)C)C |
SMILES (Isomeric) | C[C@H]1[C@@H]2CCC(=C3C([C@H]2OC1=O)C(=CC3=O)C)C |
InChI | InChI=1S/C15H18O3/c1-7-4-5-10-9(3)15(17)18-14(10)13-8(2)6-11(16)12(7)13/h6,9-10,13-14H,4-5H2,1-3H3/t9-,10-,13?,14-/m0/s1 |
InChI Key | BJPSSVHNEGMBDQ-CJJWOEGASA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H18O3 |
Molecular Weight | 246.30 g/mol |
Exact Mass | 246.125594432 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of (3S,3aS,9bS)-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione 2D Structure of (3S,3aS,9bS)-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione](https://plantaedb.com/storage/docs/compounds/2023/11/3s3as9bs-369-trimethyl-33a459a9b-hexahydroazuleno45-bfuran-27-dione.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 91.61% | 94.80% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.68% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.19% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.60% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.96% | 91.11% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.95% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.94% | 97.09% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 83.53% | 91.76% |
CHEMBL2581 | P07339 | Cathepsin D | 83.38% | 98.95% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.24% | 94.78% |
CHEMBL4072 | P07858 | Cathepsin B | 82.10% | 93.67% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.74% | 86.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.40% | 99.23% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.15% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia monosperma |
PubChem | 16760094 |
LOTUS | LTS0192479 |
wikiData | Q104937228 |