(3S)-5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one
Internal ID | 58a4096c-9661-4b8f-8b9e-20998ee7bb80 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones |
IUPAC Name | (3S)-5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1O)OCC(C2=O)C3=CC=C(C=C3)O)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1O)OC[C@@H](C2=O)C3=CC=C(C=C3)O)O)C |
InChI | InChI=1S/C20H20O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9,15,21-23H,8,10H2,1-2H3/t15-/m1/s1 |
InChI Key | UYDQKAKPHFFLDY-OAHLLOKOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H20O5 |
Molecular Weight | 340.40 g/mol |
Exact Mass | 340.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 4.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.32% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.90% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.19% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.72% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.71% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.32% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.44% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.19% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.15% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.93% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.63% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.88% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.88% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.75% | 96.09% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.01% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vigna angularis |
PubChem | 162927561 |
LOTUS | LTS0102897 |
wikiData | Q105281327 |