(3S)-3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one
Internal ID | 369ae15d-d6d0-48a0-888d-6907cf4b4149 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 8-prenylated isoflavanones |
IUPAC Name | (3S)-3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C(CO2)C3=C(C=C(C=C3)O)O)CC=C(C)C)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C2C(=C1O)C(=O)[C@H](CO2)C3=C(C=C(C=C3)O)O)CC=C(C)C)O)C |
InChI | InChI=1S/C25H28O6/c1-13(2)5-8-17-22(28)18(9-6-14(3)4)25-21(23(17)29)24(30)19(12-31-25)16-10-7-15(26)11-20(16)27/h5-7,10-11,19,26-29H,8-9,12H2,1-4H3/t19-/m1/s1 |
InChI Key | LYELCCACUCFABR-LJQANCHMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H28O6 |
Molecular Weight | 424.50 g/mol |
Exact Mass | 424.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 6.10 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.42% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.20% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.43% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.14% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.20% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.34% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.30% | 86.33% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.83% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.94% | 100.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.74% | 96.12% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.39% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.99% | 85.14% |
CHEMBL240 | Q12809 | HERG | 85.76% | 89.76% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.58% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.22% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.44% | 90.71% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.93% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.44% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.18% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.10% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina addisoniae |
Erythrina variegata |
PubChem | 26213317 |
LOTUS | LTS0059752 |
wikiData | Q105159261 |