[(3S)-2-formyl-3-[(1S,3S)-2-oxo-3-propan-2-ylcyclopentyl]cyclopenten-1-yl]methyl acetate
| Internal ID | 954e7aa3-4da8-4251-bd7f-c6fcb003a582 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [(3S)-2-formyl-3-[(1S,3S)-2-oxo-3-propan-2-ylcyclopentyl]cyclopenten-1-yl]methyl acetate |
| SMILES (Canonical) | CC(C)C1CCC(C1=O)C2CCC(=C2C=O)COC(=O)C |
| SMILES (Isomeric) | CC(C)[C@@H]1CC[C@H](C1=O)[C@@H]2CCC(=C2C=O)COC(=O)C |
| InChI | InChI=1S/C17H24O4/c1-10(2)13-6-7-15(17(13)20)14-5-4-12(16(14)8-18)9-21-11(3)19/h8,10,13-15H,4-7,9H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChI Key | ITRSJJOQXWXAJO-KKUMJFAQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.16745924 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
![2D Structure of [(3S)-2-formyl-3-[(1S,3S)-2-oxo-3-propan-2-ylcyclopentyl]cyclopenten-1-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/3s-2-formyl-3-1s3s-2-oxo-3-propan-2-ylcyclopentylcyclopenten-1-ylmethyl-acetate.jpg "2D Structure of [(3S)-2-formyl-3-[(1S,3S)-2-oxo-3-propan-2-ylcyclopentyl]cyclopenten-1-yl]methyl acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.15% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.53% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.11% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.06% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.39% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.17% | 95.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.95% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.65% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.54% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.14% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.20% | 94.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.06% | 90.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.55% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.47% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23729982 |
| LOTUS | LTS0220283 |
| wikiData | Q105120257 |