(3S)-10-hydroxy-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromen-4-one
| Internal ID | bce24f87-2f20-4917-ab1a-d0eb9eb3c5d9 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | (3S)-10-hydroxy-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromen-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H16O5/c1-8-15(17)11-5-9-4-10(19-2)6-13(20-3)14(9)16(18)12(11)7-21-8/h4-6,8,18H,7H2,1-3H3/t8-/m0/s1 |
| InChI Key | UOFWHQMYJLZYQW-QMMMGPOBSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.09977361 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of (3S)-10-hydroxy-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/3s-10-hydroxy-79-dimethoxy-3-methyl-1h-benzogisochromen-4-one.jpg "2D Structure of (3S)-10-hydroxy-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.27% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.80% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.61% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.55% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.56% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.75% | 89.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 86.67% | 94.42% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.45% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.14% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.79% | 86.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.52% | 90.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.48% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.23% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.77% | 99.23% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.03% | 96.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.11% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.08% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584223 |
| LOTUS | LTS0132883 |
| wikiData | Q105276322 |