(3R,6S)-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine-3,8-diol
Internal ID | eee9ae65-9bd1-4f15-aff1-417d8496aba2 |
Taxonomy | Organoheterocyclic compounds > Oxocins |
IUPAC Name | (3R,6S)-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine-3,8-diol |
SMILES (Canonical) | CC1CCC(C(OC2=C1C=C(C(=C2)C)O)(C)C)O |
SMILES (Isomeric) | C[C@H]1CC[C@H](C(OC2=C1C=C(C(=C2)C)O)(C)C)O |
InChI | InChI=1S/C15H22O3/c1-9-5-6-14(17)15(3,4)18-13-7-10(2)12(16)8-11(9)13/h7-9,14,16-17H,5-6H2,1-4H3/t9-,14+/m0/s1 |
InChI Key | FWVBSUZWRAYTJB-LKFCYVNXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H22O3 |
Molecular Weight | 250.33 g/mol |
Exact Mass | 250.15689456 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.77% | 92.94% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 89.26% | 90.24% |
CHEMBL2581 | P07339 | Cathepsin D | 88.90% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.53% | 83.82% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.48% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.53% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.88% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.83% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.91% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.43% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.72% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.36% | 95.89% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.26% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helianthus annuus |
PubChem | 10467287 |
LOTUS | LTS0079185 |
wikiData | Q105003592 |