(3R,4R)-4-[(S)-(4-hydroxy-3,5-dimethoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]-3-methyloxolan-2-one
Internal ID | 9e35758f-8aa2-4a63-b6ff-c4ec23237f7d |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylmethanes |
IUPAC Name | (3R,4R)-4-[(S)-(4-hydroxy-3,5-dimethoxyphenyl)-(3,4,5-trimethoxyphenyl)methyl]-3-methyloxolan-2-one |
SMILES (Canonical) | CC1C(COC1=O)C(C2=CC(=C(C(=C2)OC)O)OC)C3=CC(=C(C(=C3)OC)OC)OC |
SMILES (Isomeric) | C[C@@H]1[C@H](COC1=O)[C@@H](C2=CC(=C(C(=C2)OC)O)OC)C3=CC(=C(C(=C3)OC)OC)OC |
InChI | InChI=1S/C23H28O8/c1-12-15(11-31-23(12)25)20(13-7-16(26-2)21(24)17(8-13)27-3)14-9-18(28-4)22(30-6)19(10-14)29-5/h7-10,12,15,20,24H,11H2,1-6H3/t12-,15+,20+/m1/s1 |
InChI Key | VGMOUMWYTMZSAT-RAJNIJHNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H28O8 |
Molecular Weight | 432.50 g/mol |
Exact Mass | 432.17841785 g/mol |
Topological Polar Surface Area (TPSA) | 92.70 Ų |
XlogP | 3.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.43% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.17% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.89% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.43% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.33% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.14% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.04% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.62% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.36% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.19% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 85.14% | 98.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.00% | 94.45% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.72% | 89.50% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.29% | 94.80% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.16% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.92% | 99.15% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.90% | 92.62% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 81.15% | 90.20% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.87% | 95.89% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.33% | 95.56% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.00% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Peperomia heyneana |
PubChem | 162899570 |
LOTUS | LTS0213695 |
wikiData | Q105285898 |