(3R,3aR,10aS)-3-hydroxy-6,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-benzo[f]azulen-10-one
| Internal ID | f65ef5ba-898c-4307-bc28-c84bab3bb89e |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones > Aryl alkyl ketones |
| IUPAC Name | (3R,3aR,10aS)-3-hydroxy-6,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-benzo[f]azulen-10-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H28O2/c1-12(2)20(22)11-10-19(5)16(20)9-8-15-13(3)6-7-14(4)17(15)18(19)21/h6-7,12,16,22H,8-11H2,1-5H3/t16-,19+,20-/m1/s1 |
| InChI Key | UIFDMWQLGSNWIW-LSTHTHJFSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.208930132 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of (3R,3aR,10aS)-3-hydroxy-6,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-benzo[f]azulen-10-one](https://plantaedb.com/storage/docs/compounds/2023/11/3r3ar10as-3-hydroxy-6910a-trimethyl-3-propan-2-yl-23a45-tetrahydro-1h-benzofazulen-10-one.jpg "2D Structure of (3R,3aR,10aS)-3-hydroxy-6,9,10a-trimethyl-3-propan-2-yl-2,3a,4,5-tetrahydro-1H-benzo[f]azulen-10-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.14% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.77% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.42% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.38% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.69% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.84% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.09% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.26% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.15% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.88% | 93.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.69% | 93.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.59% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15690564 |
| LOTUS | LTS0089175 |
| wikiData | Q105273332 |