(3R)-3-hydroxy-8-methoxy-3-methyl-2,4-dihydrobenzo[a]anthracen-1-one
| Internal ID | 1f52077f-6e07-4ac8-b416-b2ee48db46fd |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Phenanthrols |
| IUPAC Name | (3R)-3-hydroxy-8-methoxy-3-methyl-2,4-dihydrobenzo[a]anthracen-1-one |
| SMILES (Canonical) | CC1(CC2=C(C(=O)C1)C3=C(C=C2)C=C4C(=C3)C=CC=C4OC)O |
| SMILES (Isomeric) | C[C@]1(CC2=C(C(=O)C1)C3=C(C=C2)C=C4C(=C3)C=CC=C4OC)O |
| InChI | InChI=1S/C20H18O3/c1-20(22)10-14-7-6-13-8-15-12(4-3-5-18(15)23-2)9-16(13)19(14)17(21)11-20/h3-9,22H,10-11H2,1-2H3/t20-/m1/s1 |
| InChI Key | ROQRYDSBEWKMJK-HXUWFJFHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of (3R)-3-hydroxy-8-methoxy-3-methyl-2,4-dihydrobenzo[a]anthracen-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/3r-3-hydroxy-8-methoxy-3-methyl-24-dihydrobenzoaanthracen-1-one.jpg "2D Structure of (3R)-3-hydroxy-8-methoxy-3-methyl-2,4-dihydrobenzo[a]anthracen-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.98% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.20% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.10% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.51% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.85% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.61% | 94.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.86% | 93.31% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.82% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.42% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.09% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.06% | 92.94% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 85.34% | 94.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.23% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.92% | 93.03% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.94% | 82.69% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.64% | 92.62% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.17% | 92.38% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.78% | 96.67% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.60% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102450568 |
| LOTUS | LTS0076659 |
| wikiData | Q105242409 |