(3R)-3-(dimethylamino)-3-phenylpropanoic acid
Internal ID | 0f98765b-6fc5-4dd1-8472-6cec6a501a1c |
Taxonomy | Phenylpropanoids and polyketides > Phenylpropanoic acids |
IUPAC Name | (3R)-3-(dimethylamino)-3-phenylpropanoic acid |
SMILES (Canonical) | CN(C)C(CC(=O)O)C1=CC=CC=C1 |
SMILES (Isomeric) | CN(C)[C@H](CC(=O)O)C1=CC=CC=C1 |
InChI | InChI=1S/C11H15NO2/c1-12(2)10(8-11(13)14)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,13,14)/t10-/m1/s1 |
InChI Key | JTKDHNKYUPVADI-SNVBAGLBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C11H15NO2 |
Molecular Weight | 193.24 g/mol |
Exact Mass | 193.110278721 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | -0.40 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.05% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.91% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.79% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.68% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.93% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.11% | 94.73% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.02% | 94.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.50% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.16% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus cuspidata |
PubChem | 28743062 |
LOTUS | LTS0070896 |
wikiData | Q105134820 |