(3R)-3-(4-hydroxy-2,3-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol
Internal ID | 2aa2b395-94cc-4e4b-9066-854bc56871a7 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > O-methylated isoflavonoids > 3-O-methylated isoflavonoids |
IUPAC Name | (3R)-3-(4-hydroxy-2,3-dimethoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
SMILES (Canonical) | COC1=C(C=CC(=C1OC)O)C2CC3=C(C=C(C=C3)O)OC2 |
SMILES (Isomeric) | COC1=C(C=CC(=C1OC)O)[C@H]2CC3=C(C=C(C=C3)O)OC2 |
InChI | InChI=1S/C17H18O5/c1-20-16-13(5-6-14(19)17(16)21-2)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-6,8,11,18-19H,7,9H2,1-2H3/t11-/m0/s1 |
InChI Key | HHNUTZFOMIAQMX-NSHDSACASA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H18O5 |
Molecular Weight | 302.32 g/mol |
Exact Mass | 302.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.91% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.35% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.84% | 99.15% |
CHEMBL236 | P41143 | Delta opioid receptor | 89.84% | 99.35% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.11% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.94% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.57% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.56% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.51% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 86.44% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.67% | 95.56% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 84.95% | 91.79% |
CHEMBL2535 | P11166 | Glucose transporter | 84.31% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.74% | 82.67% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.70% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.50% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.45% | 91.19% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.31% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Endosamara racemosa |
PubChem | 92286579 |
LOTUS | LTS0192255 |
wikiData | Q105028410 |