(3R)-3-(2,3,5-trimethoxyphenyl)pyrrolidine
| Internal ID | 619a8738-b98f-445a-b941-927afe2aa227 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines > Phenylpyrrolidines |
| IUPAC Name | (3R)-3-(2,3,5-trimethoxyphenyl)pyrrolidine |
| SMILES (Canonical) | COC1=CC(=C(C(=C1)OC)OC)C2CCNC2 |
| SMILES (Isomeric) | COC1=CC(=C(C(=C1)OC)OC)[C@H]2CCNC2 |
| InChI | InChI=1S/C13H19NO3/c1-15-10-6-11(9-4-5-14-8-9)13(17-3)12(7-10)16-2/h6-7,9,14H,4-5,8H2,1-3H3/t9-/m0/s1 |
| InChI Key | UMFNETQNXFCTOT-VIFPVBQESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 39.70 Ų |
| XlogP | 1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.75% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.58% | 96.09% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 94.50% | 94.55% |
| CHEMBL228 | P31645 | Serotonin transporter | 93.02% | 95.51% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.16% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.95% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.19% | 92.94% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 86.79% | 96.06% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.61% | 97.14% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.23% | 89.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.80% | 93.99% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.42% | 92.68% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.78% | 93.18% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.45% | 99.18% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.17% | 98.75% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.15% | 91.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.77% | 92.62% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.40% | 100.00% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.84% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.72% | 95.56% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.63% | 88.48% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.19% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.79% | 90.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.22% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162990434 |
| LOTUS | LTS0126182 |
| wikiData | Q105275531 |