(3R)-3-(2-hydroxypropan-2-yl)-5-methoxy-4,6-dihydro-3H-pyrano[4,3-b]carbazol-1-one
Internal ID | 52677c3d-fbf7-40f8-bbee-69f69c21543d |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (3R)-3-(2-hydroxypropan-2-yl)-5-methoxy-4,6-dihydro-3H-pyrano[4,3-b]carbazol-1-one |
SMILES (Canonical) | CC(C)(C1CC2=C(C=C3C4=CC=CC=C4NC3=C2OC)C(=O)O1)O |
SMILES (Isomeric) | CC(C)([C@H]1CC2=C(C=C3C4=CC=CC=C4NC3=C2OC)C(=O)O1)O |
InChI | InChI=1S/C19H19NO4/c1-19(2,22)15-9-12-13(18(21)24-15)8-11-10-6-4-5-7-14(10)20-16(11)17(12)23-3/h4-8,15,20,22H,9H2,1-3H3/t15-/m1/s1 |
InChI Key | VFBSYRMQKVPIHG-OAHLLOKOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H19NO4 |
Molecular Weight | 325.40 g/mol |
Exact Mass | 325.13140809 g/mol |
Topological Polar Surface Area (TPSA) | 71.60 Ų |
XlogP | 3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.32% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.71% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.71% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.65% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.59% | 91.49% |
CHEMBL2535 | P11166 | Glucose transporter | 93.57% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.56% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.57% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.52% | 89.00% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.01% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.41% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.24% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.74% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.14% | 92.62% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.93% | 93.31% |
CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 86.70% | 81.14% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.52% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.96% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.50% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.07% | 99.23% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.89% | 92.98% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 82.87% | 95.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.28% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.32% | 97.14% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.21% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena lansium |
PubChem | 163195409 |
LOTUS | LTS0041616 |
wikiData | Q105285074 |