8-methoxy-5-[(1R,3R)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-6-methylnaphthalen-1-ol
| Internal ID | a3dcd621-06f0-42bd-8e11-ec57b7964cf0 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Naphthylisoquinolines |
| IUPAC Name | 8-methoxy-5-[(1R,3R)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-6-methylnaphthalen-1-ol |
| SMILES (Canonical) | CC1CC2=C(C(N1)C)C(=C(C=C2)C3=C4C=CC=C(C4=C(C=C3C)OC)O)OC |
| SMILES (Isomeric) | C[C@@H]1CC2=C([C@H](N1)C)C(=C(C=C2)C3=C4C=CC=C(C4=C(C=C3C)OC)O)OC |
| InChI | InChI=1S/C24H27NO3/c1-13-11-20(27-4)23-17(7-6-8-19(23)26)21(13)18-10-9-16-12-14(2)25-15(3)22(16)24(18)28-5/h6-11,14-15,25-26H,12H2,1-5H3/t14-,15-/m1/s1 |
| InChI Key | RUIMCCISFFPHCE-HUUCEWRRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.19909372 g/mol |
| Topological Polar Surface Area (TPSA) | 50.70 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
![2D Structure of 8-methoxy-5-[(1R,3R)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-6-methylnaphthalen-1-ol](https://plantaedb.com/storage/docs/compounds/2023/11/3fd066e0-870b-11ee-a9c9-21fbdb0b24b1.jpg "2D Structure of 8-methoxy-5-[(1R,3R)-8-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-7-yl]-6-methylnaphthalen-1-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.92% | 91.11% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 96.53% | 91.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.22% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.70% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.62% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.33% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.00% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.91% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.47% | 96.95% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 91.27% | 92.98% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.87% | 96.21% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.79% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.25% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.16% | 93.31% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 89.82% | 97.31% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.38% | 97.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 88.92% | 95.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.76% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.54% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.07% | 99.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.91% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.90% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.89% | 90.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.64% | 95.56% |
| CHEMBL1795185 | Q58F21 | Bromodomain testis-specific protein | 85.42% | 89.76% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.93% | 94.03% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.53% | 89.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.01% | 94.45% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.40% | 97.21% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.73% | 96.39% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.67% | 93.56% |
| CHEMBL5028 | O14672 | ADAM10 | 80.50% | 97.50% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.01% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ancistrocladus abbreviatus |
| Triphyophyllum peltatum |
| PubChem | 59095071 |
| LOTUS | LTS0089085 |
| wikiData | Q105245636 |