16-[3,4-Dihydroxy-5-[5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,15,19-triol
| Internal ID | 9ebd95a7-c8ee-42db-8523-6cca3652732e |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | 16-[3,4-dihydroxy-5-[5-hydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,15,19-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC(C5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)C)O)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
| SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC(C5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)C)O)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)O |
| InChI | InChI=1S/C56H94O30/c1-19(17-76-49-43(72)39(68)36(65)30(13-57)79-49)5-8-56(75)20(2)34-29(86-56)10-23-21-9-25(61)24-11-28(26(62)12-55(24,4)22(21)6-7-54(23,34)3)78-51-45(74)41(70)46(33(16-60)82-51)83-53-48(85-52-44(73)40(69)37(66)31(14-58)80-52)47(38(67)32(15-59)81-53)84-50-42(71)35(64)27(63)18-77-50/h19-53,57-75H,5-18H2,1-4H3 |
| InChI Key | LYPZKABLHWOYRH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C56H94O30 |
| Molecular Weight | 1247.30 g/mol |
| Exact Mass | 1246.58299158 g/mol |
| Topological Polar Surface Area (TPSA) | 486.00 Ų |
| XlogP | -5.30 |
| Atomic LogP (AlogP) | -7.55 |
| H-Bond Acceptor | 30 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 18 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5246 | 52.46% |
| Caco-2 | - | 0.8768 | 87.68% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.8429 | 84.29% |
| Subcellular localzation | Mitochondria | 0.6174 | 61.74% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8780 | 87.80% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | - | 0.9612 | 96.12% |
| OCT2 inhibitior | + | 0.6250 | 62.50% |
| BSEP inhibitior | + | 0.7856 | 78.56% |
| P-glycoprotein inhibitior | + | 0.7424 | 74.24% |
| P-glycoprotein substrate | + | 0.6144 | 61.44% |
| CYP3A4 substrate | + | 0.7554 | 75.54% |
| CYP2C9 substrate | - | 0.8016 | 80.16% |
| CYP2D6 substrate | - | 0.8288 | 82.88% |
| CYP3A4 inhibition | - | 0.9473 | 94.73% |
| CYP2C9 inhibition | - | 0.9215 | 92.15% |
| CYP2C19 inhibition | - | 0.8997 | 89.97% |
| CYP2D6 inhibition | - | 0.9561 | 95.61% |
| CYP1A2 inhibition | - | 0.9215 | 92.15% |
| CYP2C8 inhibition | + | 0.6953 | 69.53% |
| CYP inhibitory promiscuity | - | 0.9616 | 96.16% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9800 | 98.00% |
| Carcinogenicity (trinary) | Non-required | 0.6223 | 62.23% |
| Eye corrosion | - | 0.9917 | 99.17% |
| Eye irritation | - | 0.9014 | 90.14% |
| Skin irritation | - | 0.6555 | 65.55% |
| Skin corrosion | - | 0.9521 | 95.21% |
| Ames mutagenesis | - | 0.7056 | 70.56% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.8129 | 81.29% |
| Micronuclear | - | 0.9100 | 91.00% |
| Hepatotoxicity | - | 0.8658 | 86.58% |
| skin sensitisation | - | 0.9420 | 94.20% |
| Respiratory toxicity | + | 0.6111 | 61.11% |
| Reproductive toxicity | + | 0.7000 | 70.00% |
| Mitochondrial toxicity | - | 0.5375 | 53.75% |
| Nephrotoxicity | - | 0.9388 | 93.88% |
| Acute Oral Toxicity (c) | I | 0.8185 | 81.85% |
| Estrogen receptor binding | + | 0.8541 | 85.41% |
| Androgen receptor binding | + | 0.7009 | 70.09% |
| Thyroid receptor binding | + | 0.5303 | 53.03% |
| Glucocorticoid receptor binding | + | 0.6461 | 64.61% |
| Aromatase binding | + | 0.6531 | 65.31% |
| PPAR gamma | + | 0.7843 | 78.43% |
| Honey bee toxicity | - | 0.5679 | 56.79% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
| Fish aquatic toxicity | + | 0.7523 | 75.23% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 98.37% | 96.61% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.87% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.83% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.54% | 96.21% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.25% | 92.86% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 94.46% | 92.98% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.15% | 97.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.29% | 97.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.56% | 90.17% |
| CHEMBL204 | P00734 | Thrombin | 91.33% | 96.01% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.14% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.10% | 97.25% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 89.97% | 97.64% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.55% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.16% | 94.45% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.76% | 95.58% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.34% | 96.77% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 87.25% | 92.78% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 87.17% | 95.36% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.96% | 98.35% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 86.94% | 97.86% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.87% | 98.10% |
| CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 86.44% | 87.38% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.20% | 93.18% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.69% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.40% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.04% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.81% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.05% | 91.03% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 83.51% | 94.45% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.37% | 100.00% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.28% | 99.17% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.27% | 98.05% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.26% | 92.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.39% | 98.75% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.29% | 93.56% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.27% | 92.88% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.99% | 89.00% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 81.76% | 96.67% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.74% | 91.24% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.46% | 89.05% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.33% | 92.32% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.14% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium schubertii |
| PubChem | 163035068 |
| LOTUS | LTS0195349 |
| wikiData | Q105159487 |