[1-(1-acetyloxyethyl)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] (E)-3-methylpent-2-enoate
Internal ID | fcd57ed6-e585-4b73-8c35-eaf83fc463b9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | [1-(1-acetyloxyethyl)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] (E)-3-methylpent-2-enoate |
SMILES (Canonical) | CCC(=CC(=O)OC1CC(C2C(C1=C)CC(=O)C2C(C)OC(=O)C)C(C)C)C |
SMILES (Isomeric) | CC/C(=C/C(=O)OC1CC(C2C(C1=C)CC(=O)C2C(C)OC(=O)C)C(C)C)/C |
InChI | InChI=1S/C23H34O5/c1-8-13(4)9-21(26)28-20-11-17(12(2)3)23-18(14(20)5)10-19(25)22(23)15(6)27-16(7)24/h9,12,15,17-18,20,22-23H,5,8,10-11H2,1-4,6-7H3/b13-9+ |
InChI Key | CFUPNMDNSQIWBB-UKTHLTGXSA-N |
Popularity | 26 references in papers |
Molecular Formula | C23H34O5 |
Molecular Weight | 390.50 g/mol |
Exact Mass | 390.24062418 g/mol |
Topological Polar Surface Area (TPSA) | 69.70 Ų |
XlogP | 4.10 |
[(1S,3Ar,5R,7S,7aS)-1-[(1R)-1-acetyloxyethyl]-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] (E)-3-methylpent-2-enoate |
[1-(1-acetyloxyethyl)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] (E)-3-methylpent-2-enoate |
104012-37-5 |
![2D Structure of [1-(1-acetyloxyethyl)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] (E)-3-methylpent-2-enoate 2D Structure of [1-(1-acetyloxyethyl)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-5-yl] (E)-3-methylpent-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/3f2faa50-85cb-11ee-9f61-e583da4ac4cb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.25% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.82% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.90% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.27% | 90.17% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.02% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.27% | 94.45% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.69% | 97.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.42% | 99.17% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.87% | 89.34% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.86% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.72% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.71% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.44% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.43% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.57% | 89.00% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.08% | 94.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.59% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tussilago farfara |
PubChem | 13919184 |
LOTUS | LTS0265469 |
wikiData | Q104957017 |