[(2S,3R,4R,5R,6S)-2-[(2S,3S,4R,5R,6S)-3-[(2S,3R,4S,5S,6S)-3,4-dihydroxy-6-methyl-5-(2-methylbutanoyloxy)oxan-2-yl]oxy-5-dodecanoyloxy-2-methyl-6-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25R,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]oxan-4-yl]oxy-4,5-dihydroxy-6-methyloxan-3-yl] (11S)-11-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-5-[(2S,3R,4S,5S,6S)-3-hydroxy-5-[(2S,3R,4S,5S,6S)-3-hydroxy-6-methyl-5-(2-methylbutanoyloxy)-4-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-6-methyl-4-[(1R,2R,3R,4S,5R)-2,3,4-trihydroxy-5-methylcyclohexyl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxyhexadecanoate
Internal ID | 20615616-891e-4af3-b5b1-2c6ac3ee707f |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4R,5R,6S)-2-[(2S,3S,4R,5R,6S)-3-[(2S,3R,4S,5S,6S)-3,4-dihydroxy-6-methyl-5-(2-methylbutanoyloxy)oxan-2-yl]oxy-5-dodecanoyloxy-2-methyl-6-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25R,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]oxan-4-yl]oxy-4,5-dihydroxy-6-methyloxan-3-yl] (11S)-11-[(2R,3R,4S,5R,6R)-3-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-5-[(2S,3R,4S,5S,6S)-3-hydroxy-5-[(2S,3R,4S,5S,6S)-3-hydroxy-6-methyl-5-(2-methylbutanoyloxy)-4-[(E)-3-phenylprop-2-enoyl]oxyoxan-2-yl]oxy-6-methyl-4-[(1R,2R,3R,4S,5R)-2,3,4-trihydroxy-5-methylcyclohexyl]oxyoxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4,5-dihydroxy-6-methyloxan-2-yl]oxyhexadecanoate |
SMILES (Canonical) | CCCCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC3C(C2O)OC(=O)CCCCCCCCCC(OC4C(O3)C(C(C(O4)C)O)O)CCCCC)C)C)OC5C(C(C(C(O5)C)OC(=O)C(C)CC)O)O)OC6C(C(C(C(O6)C)O)O)OC(=O)CCCCCCCCCC(CCCCC)OC7C(C(C(C(O7)C)O)O)OC8C(C(C(C(O8)C)OC9C(C(C(C(O9)C)OC1C(C(C(C(O1)C)OC(=O)C(C)CC)OC(=O)C=CC1=CC=CC=C1)O)OC1CC(C(C(C1O)O)O)C)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@@H]3[C@@H]([C@@H]2O)OC(=O)CCCCCCCCC[C@@H](O[C@H]4[C@H](O3)[C@H]([C@H]([C@H](O4)C)O)O)CCCCC)C)C)O[C@H]5[C@@H]([C@@H]([C@@H]([C@@H](O5)C)OC(=O)C(C)CC)O)O)O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)OC(=O)CCCCCCCCC[C@H](CCCCC)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)C)O)O)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)OC(=O)C(C)CC)OC(=O)/C=C/C1=CC=CC=C1)O)O[C@@H]1C[C@H]([C@@H]([C@H]([C@H]1O)O)O)C)O)O)O |
InChI | InChI=1S/C124H206O47/c1-18-23-26-27-28-29-34-39-51-60-82(127)162-113-112(105(168-116-95(140)93(138)100(70(12)150-116)163-114(145)64(6)21-4)75(17)155-124(113)166-102-72(14)154-123-111(97(102)142)161-81(126)59-50-41-36-31-33-38-48-57-78(55-44-25-20-3)157-121-110(170-123)92(137)87(132)68(10)148-121)171-122-108(90(135)85(130)69(11)149-122)160-80(125)58-49-40-35-30-32-37-47-56-77(54-43-24-19-2)156-120-109(91(136)86(131)67(9)147-120)169-117-96(141)94(139)101(71(13)151-117)165-118-98(143)106(158-79-63-66(8)84(129)89(134)88(79)133)104(74(16)153-118)167-119-99(144)107(103(73(15)152-119)164-115(146)65(7)22-5)159-83(128)62-61-76-52-45-42-46-53-76/h42,45-46,52-53,61-62,64-75,77-79,84-113,116-124,129-144H,18-41,43-44,47-51,54-60,63H2,1-17H3/b62-61+/t64?,65?,66-,67-,68-,69+,70+,71+,72+,73+,74+,75+,77+,78+,79-,84+,85+,86+,87+,88+,89-,90-,91+,92+,93+,94+,95-,96-,97-,98-,99-,100-,101+,102+,103+,104+,105+,106+,107+,108-,109-,110-,111-,112-,113-,116+,117+,118+,119+,120+,121+,122+,123+,124+/m1/s1 |
InChI Key | NKXXQFOOOHJLRQ-DYFOXTGPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C124H206O47 |
Molecular Weight | 2448.90 g/mol |
Exact Mass | 2448.3762985 g/mol |
Topological Polar Surface Area (TPSA) | 657.00 Ų |
XlogP | 14.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.52% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.18% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.49% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.41% | 96.09% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 96.46% | 94.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.98% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.96% | 93.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.94% | 83.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.59% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.41% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.37% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.12% | 92.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.01% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.47% | 97.09% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.33% | 85.94% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.43% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.16% | 93.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.92% | 91.49% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.55% | 91.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.04% | 97.36% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.89% | 95.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 89.04% | 95.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.31% | 94.62% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.09% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.93% | 90.17% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 86.81% | 96.37% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.47% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.63% | 99.23% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.41% | 94.23% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.59% | 92.97% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.69% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.27% | 95.89% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 81.98% | 92.12% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 81.84% | 92.98% |
CHEMBL5028 | O14672 | ADAM10 | 81.39% | 97.50% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.12% | 96.25% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.91% | 92.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.67% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea batatas |
PubChem | 162820123 |
LOTUS | LTS0200392 |
wikiData | Q103813585 |